C22H17F4N3OS2 — CID 19316673
2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)acetamide (PubChem CID 19316673) has the molecular formula C22H17F4N3OS2 and a molecular weight of 479.52 g/mol. Its IUPAC name is 2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)acetamide.
| Compound Name | 2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)acetamide |
|---|---|
| PubChem CID | 19316673 |
| Molecular Formula | C22H17F4N3OS2 |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)acetamide |
| SMILES | Cc1ccc(NC(=S)Nc2cccc(SCC(=O)Nc3c(F)c(F)cc(F)c3F)c2)cc1 |
| InChI | InChI=1S/C22H17F4N3OS2/c1-12-5-7-13(8-6-12)27-22(31)28-14-3-2-4-15(9-14)32-11-18(30)29-21-19(25)16(23)10-17(24)20(21)26/h2-10H,11H2,1H3,(H,29,30)(H2,27,28,31) |
| InChIKey | UTMOZRZZEKFVFP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|