C31H24N2O4S — CID 19298827
N-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]-2-methylbenzamide (PubChem CID 19298827) has the molecular formula C31H24N2O4S and a molecular weight of 520.61 g/mol. Its IUPAC name is N-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]-2-methylbenzamide.
| Compound Name | N-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 19298827 |
| Molecular Formula | C31H24N2O4S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | N-[3-[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cccc(SC(C)C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C31H24N2O4S/c1-18-9-3-4-12-22(18)31(37)32-20-10-7-11-21(17-20)38-19(2)30(36)33-26-16-8-15-25-27(26)29(35)24-14-6-5-13-23(24)28(25)34/h3-17,19H,1-2H3,(H,32,37)(H,33,36) |
| InChIKey | YIODMAPAHJDTLH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|