C31H24N2O6S — CID 21169719
N-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2,6-dimethoxybenzamide (PubChem CID 21169719) has the molecular formula C31H24N2O6S and a molecular weight of 552.61 g/mol. Its IUPAC name is N-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 21169719 |
| Molecular Formula | C31H24N2O6S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | N-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(SCC(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C31H24N2O6S/c1-38-24-11-6-12-25(39-2)28(24)31(37)32-18-13-15-19(16-14-18)40-17-26(34)33-23-10-5-9-22-27(23)30(36)21-8-4-3-7-20(21)29(22)35/h3-16H,17H2,1-2H3,(H,32,37)(H,33,34) |
| InChIKey | PZKOAFVEPBQSMF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|