C20H18N2O3S2 — CID 19630801
N-[4-[2-(2-methoxyanilino)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 19630801) has the molecular formula C20H18N2O3S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[4-[2-(2-methoxyanilino)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-(2-methoxyanilino)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19630801 |
| Molecular Formula | C20H18N2O3S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-[4-[2-(2-methoxyanilino)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)CSc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H18N2O3S2/c1-25-17-6-3-2-5-16(17)22-19(23)13-27-15-10-8-14(9-11-15)21-20(24)18-7-4-12-26-18/h2-12H,13H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | KBBBUDJWPRKJOW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |