C19H14ClNO2S2 — CID 19629990
N-[4-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 19629990) has the molecular formula C19H14ClNO2S2 and a molecular weight of 387.91 g/mol. Its IUPAC name is N-[4-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19629990 |
| Molecular Formula | C19H14ClNO2S2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | N-[4-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(SCC(=O)c2ccccc2Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C19H14ClNO2S2/c20-16-5-2-1-4-15(16)17(22)12-25-14-9-7-13(8-10-14)21-19(23)18-6-3-11-24-18/h1-11H,12H2,(H,21,23) |
| InChIKey | ASOXVXPKXZNDMS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |