C18H14ClN3O2S2 — CID 19631271
N-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 19631271) has the molecular formula C18H14ClN3O2S2 and a molecular weight of 403.92 g/mol. Its IUPAC name is N-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19631271 |
| Molecular Formula | C18H14ClN3O2S2 |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | N-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | O=C(CSc1ccc(NC(=O)c2cccs2)cc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H14ClN3O2S2/c19-12-3-8-16(20-10-12)22-17(23)11-26-14-6-4-13(5-7-14)21-18(24)15-2-1-9-25-15/h1-10H,11H2,(H,21,24)(H,20,22,23) |
| InChIKey | CFYQBQJLVPQTPQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |