C18H15N3O2S2 — CID 19298764
N-[3-[2-oxo-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 19298764) has the molecular formula C18H15N3O2S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[3-[2-oxo-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[2-oxo-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19298764 |
| Molecular Formula | C18H15N3O2S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-[3-[2-oxo-2-(pyridin-4-ylamino)ethyl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | O=C(CSc1cccc(NC(=O)c2cccs2)c1)Nc1ccncc1 |
| InChI | InChI=1S/C18H15N3O2S2/c22-17(20-13-6-8-19-9-7-13)12-25-15-4-1-3-14(11-15)21-18(23)16-5-2-10-24-16/h1-11H,12H2,(H,21,23)(H,19,20,22) |
| InChIKey | BWWFLRVFPBCRBL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |