C27H23N3O2S2 — CID 19298769
N-[3-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 19298769) has the molecular formula C27H23N3O2S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[3-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19298769 |
| Molecular Formula | C27H23N3O2S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | N-[3-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CSc3cccc(NC(=O)c4cccs4)c3)ccc21 |
| InChI | InChI=1S/C27H23N3O2S2/c1-2-30-23-10-4-3-9-21(23)22-16-19(12-13-24(22)30)28-26(31)17-34-20-8-5-7-18(15-20)29-27(32)25-11-6-14-33-25/h3-16H,2,17H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | WYRTUAHBJIAUFW-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |