C26H23N3O4S — CID 22785050
(E)-4-[4-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 22785050) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is (E)-4-[4-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 22785050 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (E)-4-[4-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CSc3ccc(NC(=O)/C=C/C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C26H23N3O4S/c1-2-29-22-6-4-3-5-20(22)21-15-18(9-12-23(21)29)28-25(31)16-34-19-10-7-17(8-11-19)27-24(30)13-14-26(32)33/h3-15H,2,16H2,1H3,(H,27,30)(H,28,31)(H,32,33)/b14-13+ |
| InChIKey | FFBUVMZBNPYMOK-BUHFOSPRSA-N |
| XLogP | 5.12 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|