C20H15F3N2O2S2 — CID 22780441
N-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 22780441) has the molecular formula C20H15F3N2O2S2 and a molecular weight of 436.48 g/mol. Its IUPAC name is N-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 22780441 |
| Molecular Formula | C20H15F3N2O2S2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | O=C(CSc1ccc(NC(=O)c2cccs2)cc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H15F3N2O2S2/c21-20(22,23)15-4-1-2-5-16(15)25-18(26)12-29-14-9-7-13(8-10-14)24-19(27)17-6-3-11-28-17/h1-11H,12H2,(H,24,27)(H,25,26) |
| InChIKey | CVEOLVHBRONLSM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |