C23H19F3N2O2S — CID 22781682
4-methyl-N-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide (PubChem CID 22781682) has the molecular formula C23H19F3N2O2S and a molecular weight of 444.48 g/mol. Its IUPAC name is 4-methyl-N-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide.
| Compound Name | 4-methyl-N-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 22781682 |
| Molecular Formula | C23H19F3N2O2S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 4-methyl-N-[4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(SCC(=O)Nc3ccccc3C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H19F3N2O2S/c1-15-6-8-16(9-7-15)22(30)27-17-10-12-18(13-11-17)31-14-21(29)28-20-5-3-2-4-19(20)23(24,25)26/h2-13H,14H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | RGFRGJRRLRGONS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |