C22H17Cl2NO2S — CID 22779193
2-(4-chlorophenyl)-N-[4-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]acetamide (PubChem CID 22779193) has the molecular formula C22H17Cl2NO2S and a molecular weight of 430.36 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[4-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[4-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 22779193 |
| Molecular Formula | C22H17Cl2NO2S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[4-[2-(2-chlorophenyl)-2-oxoethyl]sulfanylphenyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nc1ccc(SCC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H17Cl2NO2S/c23-16-7-5-15(6-8-16)13-22(27)25-17-9-11-18(12-10-17)28-14-21(26)19-3-1-2-4-20(19)24/h1-12H,13-14H2,(H,25,27) |
| InChIKey | BLJCPVUFTDSSOG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |