C25H21ClN4O3S — CID 23099331
2-(4-chlorophenyl)-N-[4-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylphenyl]acetamide (PubChem CID 23099331) has the molecular formula C25H21ClN4O3S and a molecular weight of 492.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[4-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylphenyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[4-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 23099331 |
| Molecular Formula | C25H21ClN4O3S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[4-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylphenyl]acetamide |
| SMILES | O=C(CSc1ccc(NC(=O)Cc2ccc(Cl)cc2)cc1)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C25H21ClN4O3S/c26-18-8-6-17(7-9-18)14-23(31)27-19-10-12-21(13-11-19)34-16-24(32)28-22-15-25(33)30(29-22)20-4-2-1-3-5-20/h1-13H,14-16H2,(H,27,31)(H,28,29,32) |
| InChIKey | JQMSXXNHGUULIG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|