C24H21N5O2S2 — CID 19712673
N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19712673) has the molecular formula C24H21N5O2S2 and a molecular weight of 475.60 g/mol. Its IUPAC name is N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19712673 |
| Molecular Formula | C24H21N5O2S2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(NC(=S)Nc2ccccc2)cc1)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C24H21N5O2S2/c30-22(27-21-15-23(31)29(28-21)19-9-5-2-6-10-19)16-33-20-13-11-18(12-14-20)26-24(32)25-17-7-3-1-4-8-17/h1-14H,15-16H2,(H2,25,26,32)(H,27,28,30) |
| InChIKey | SYHNNCXQWCEXNX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|