C33H26ClN5O4S — CID 19319113
N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19319113) has the molecular formula C33H26ClN5O4S and a molecular weight of 624.12 g/mol. Its IUPAC name is N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319113 |
| Molecular Formula | C33H26ClN5O4S |
| Molecular Weight | 624.12 g/mol |
| Exact Mass | 623.14 |
| IUPAC Name | N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C/c2cccc(Cl)c2)NC(=O)c2ccccc2)c1)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C33H26ClN5O4S/c34-24-12-7-9-22(17-24)18-28(36-32(42)23-10-3-1-4-11-23)33(43)35-25-13-8-16-27(19-25)44-21-30(40)37-29-20-31(41)39(38-29)26-14-5-2-6-15-26/h1-19H,20-21H2,(H,35,43)(H,36,42)(H,37,38,40)/b28-18- |
| InChIKey | KTFDCOYQUISFAJ-VEILYXNESA-N |
| XLogP | 5.71 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.12 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|