C36H33N5O5S — CID 19320067
N-[(Z)-1-(3-methoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19320067) has the molecular formula C36H33N5O5S and a molecular weight of 647.76 g/mol. Its IUPAC name is N-[(Z)-1-(3-methoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3-methoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19320067 |
| Molecular Formula | C36H33N5O5S |
| Molecular Weight | 647.76 g/mol |
| Exact Mass | 647.22 |
| IUPAC Name | N-[(Z)-1-(3-methoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2cccc(OC)c2)NC(=O)c2ccccc2)c1)C(=O)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C36H33N5O5S/c1-3-31(36(45)39-32-23-33(42)41(40-32)27-16-8-5-9-17-27)47-29-19-11-15-26(22-29)37-35(44)30(21-24-12-10-18-28(20-24)46-2)38-34(43)25-13-6-4-7-14-25/h4-22,31H,3,23H2,1-2H3,(H,37,44)(H,38,43)(H,39,40,45)/b30-21- |
| InChIKey | JOZQPQMYFFORLG-OFWBYEQRSA-N |
| XLogP | 5.84 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.76 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|