C27H26N4O4S — CID 18912887
3-methoxy-N-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylphenyl]benzamide (PubChem CID 18912887) has the molecular formula C27H26N4O4S and a molecular weight of 502.60 g/mol. Its IUPAC name is 3-methoxy-N-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 3-methoxy-N-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18912887 |
| Molecular Formula | C27H26N4O4S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 3-methoxy-N-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylphenyl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2cccc(OC)c2)c1)C(=O)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C27H26N4O4S/c1-3-23(27(34)29-24-17-25(32)31(30-24)20-11-5-4-6-12-20)36-22-14-8-10-19(16-22)28-26(33)18-9-7-13-21(15-18)35-2/h4-16,23H,3,17H2,1-2H3,(H,28,33)(H,29,30,34) |
| InChIKey | WAZNTWWYRFGWLK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|