C25H25N3O4S — CID 18903443
2-[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylbutanoylamino]benzamide (PubChem CID 18903443) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylbutanoylamino]benzamide.
| Compound Name | 2-[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylbutanoylamino]benzamide |
|---|---|
| PubChem CID | 18903443 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylbutanoylamino]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2cccc(OC)c2)c1)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C25H25N3O4S/c1-3-22(25(31)28-21-13-5-4-12-20(21)23(26)29)33-19-11-7-9-17(15-19)27-24(30)16-8-6-10-18(14-16)32-2/h4-15,22H,3H2,1-2H3,(H2,26,29)(H,27,30)(H,28,31) |
| InChIKey | OXCQIDWXTJJOQP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |