C24H23ClN2O3S — CID 18903385
N-[3-[1-(3-chloroanilino)-1-oxobutan-2-yl]sulfanylphenyl]-3-methoxybenzamide (PubChem CID 18903385) has the molecular formula C24H23ClN2O3S and a molecular weight of 454.98 g/mol. Its IUPAC name is N-[3-[1-(3-chloroanilino)-1-oxobutan-2-yl]sulfanylphenyl]-3-methoxybenzamide.
| Compound Name | N-[3-[1-(3-chloroanilino)-1-oxobutan-2-yl]sulfanylphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 18903385 |
| Molecular Formula | C24H23ClN2O3S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-[3-[1-(3-chloroanilino)-1-oxobutan-2-yl]sulfanylphenyl]-3-methoxybenzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2cccc(OC)c2)c1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H23ClN2O3S/c1-3-22(24(29)27-18-9-5-8-17(25)14-18)31-21-12-6-10-19(15-21)26-23(28)16-7-4-11-20(13-16)30-2/h4-15,22H,3H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | VDKHFOYLCMFQRS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |