C23H29N3O3S — CID 18907475
2-[2-[3-(3,3-dimethylbutanoylamino)phenyl]sulfanylbutanoylamino]benzamide (PubChem CID 18907475) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-[2-[3-(3,3-dimethylbutanoylamino)phenyl]sulfanylbutanoylamino]benzamide.
| Compound Name | 2-[2-[3-(3,3-dimethylbutanoylamino)phenyl]sulfanylbutanoylamino]benzamide |
|---|---|
| PubChem CID | 18907475 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-[2-[3-(3,3-dimethylbutanoylamino)phenyl]sulfanylbutanoylamino]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)CC(C)(C)C)c1)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C23H29N3O3S/c1-5-19(22(29)26-18-12-7-6-11-17(18)21(24)28)30-16-10-8-9-15(13-16)25-20(27)14-23(2,3)4/h6-13,19H,5,14H2,1-4H3,(H2,24,28)(H,25,27)(H,26,29) |
| InChIKey | GABUTKNMKGGWDI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |