C24H22N4O4S — CID 18913175
N-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 18913175) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18913175 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]butan-2-yl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccco2)c1)C(=O)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C24H22N4O4S/c1-2-20(24(31)26-21-15-22(29)28(27-21)17-9-4-3-5-10-17)33-18-11-6-8-16(14-18)25-23(30)19-12-7-13-32-19/h3-14,20H,2,15H2,1H3,(H,25,30)(H,26,27,31) |
| InChIKey | UEXMLGJQJWYKQC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|