C30H23FN4O3S — CID 18913049
2-fluoro-N-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylphenyl]benzamide (PubChem CID 18913049) has the molecular formula C30H23FN4O3S and a molecular weight of 538.60 g/mol. Its IUPAC name is 2-fluoro-N-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylphenyl]benzamide.
| Compound Name | 2-fluoro-N-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18913049 |
| Molecular Formula | C30H23FN4O3S |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 2-fluoro-N-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]-1-phenylethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)NC2=NN(c3ccccc3)C(=O)C2)c2ccccc2)c1)c1ccccc1F |
| InChI | InChI=1S/C30H23FN4O3S/c31-25-17-8-7-16-24(25)29(37)32-21-12-9-15-23(18-21)39-28(20-10-3-1-4-11-20)30(38)33-26-19-27(36)35(34-26)22-13-5-2-6-14-22/h1-18,28H,19H2,(H,32,37)(H,33,34,38) |
| InChIKey | YOHUHXJNDPLALO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|