C29H24N4O4S2 — CID 21169947
2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2-phenylacetamide (PubChem CID 21169947) has the molecular formula C29H24N4O4S2 and a molecular weight of 556.67 g/mol. Its IUPAC name is 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2-phenylacetamide.
| Compound Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 21169947 |
| Molecular Formula | C29H24N4O4S2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2-phenylacetamide |
| SMILES | O=C(NC1=NN(c2ccccc2)C(=O)C1)C(Sc1ccc(NS(=O)(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H24N4O4S2/c34-27-20-26(31-33(27)23-12-6-2-7-13-23)30-29(35)28(21-10-4-1-5-11-21)38-24-18-16-22(17-19-24)32-39(36,37)25-14-8-3-9-15-25/h1-19,28,32H,20H2,(H,30,31,35) |
| InChIKey | UFUMHNFSXLUVIU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|