C28H21FN2O4S — CID 23100077
3-[[2-[4-[(2-fluorobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid (PubChem CID 23100077) has the molecular formula C28H21FN2O4S and a molecular weight of 500.55 g/mol. Its IUPAC name is 3-[[2-[4-[(2-fluorobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid.
| Compound Name | 3-[[2-[4-[(2-fluorobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23100077 |
| Molecular Formula | C28H21FN2O4S |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 3-[[2-[4-[(2-fluorobenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)C(Sc2ccc(NC(=O)c3ccccc3F)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H21FN2O4S/c29-24-12-5-4-11-23(24)26(32)30-20-13-15-22(16-14-20)36-25(18-7-2-1-3-8-18)27(33)31-21-10-6-9-19(17-21)28(34)35/h1-17,25H,(H,30,32)(H,31,33)(H,34,35) |
| InChIKey | JSNHAYDIVKHZLI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |