C27H20FIN2O2S — CID 21170954
2-fluoro-N-[4-[2-(4-iodoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide (PubChem CID 21170954) has the molecular formula C27H20FIN2O2S and a molecular weight of 582.44 g/mol. Its IUPAC name is 2-fluoro-N-[4-[2-(4-iodoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[2-(4-iodoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 21170954 |
| Molecular Formula | C27H20FIN2O2S |
| Molecular Weight | 582.44 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | 2-fluoro-N-[4-[2-(4-iodoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc(I)cc2)c2ccccc2)cc1)c1ccccc1F |
| InChI | InChI=1S/C27H20FIN2O2S/c28-24-9-5-4-8-23(24)26(32)30-21-14-16-22(17-15-21)34-25(18-6-2-1-3-7-18)27(33)31-20-12-10-19(29)11-13-20/h1-17,25H,(H,30,32)(H,31,33) |
| InChIKey | KSSMXOGBRXPXRM-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.44 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|