C21H16N4O4 — CID 17341622
N-[3-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 17341622) has the molecular formula C21H16N4O4 and a molecular weight of 388.38 g/mol. Its IUPAC name is N-[3-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17341622 |
| Molecular Formula | C21H16N4O4 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[3-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(NC1=NN(c2ccccc2)C(=O)C1)c1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C21H16N4O4/c26-19-13-18(24-25(19)16-8-2-1-3-9-16)23-20(27)14-6-4-7-15(12-14)22-21(28)17-10-5-11-29-17/h1-12H,13H2,(H,22,28)(H,23,24,27) |
| InChIKey | ZKWMABQRZFFNMJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|