C36H33N5O6S — CID 19319671
N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19319671) has the molecular formula C36H33N5O6S and a molecular weight of 663.76 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319671 |
| Molecular Formula | C36H33N5O6S |
| Molecular Weight | 663.76 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]propan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C)C(=O)NC3=NN(c4ccccc4)C(=O)C3)c2)c1 |
| InChI | InChI=1S/C36H33N5O6S/c1-23(34(43)39-32-22-33(42)41(40-32)27-14-8-5-9-15-27)48-29-16-10-13-26(21-29)37-36(45)30(38-35(44)24-11-6-4-7-12-24)20-25-19-28(46-2)17-18-31(25)47-3/h4-21,23H,22H2,1-3H3,(H,37,45)(H,38,44)(H,39,40,43)/b30-20+ |
| InChIKey | DOMUYJHIRUTNCD-TWKHWXDSSA-N |
| XLogP | 5.46 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.76 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|