C35H35N3O4S — CID 19309522
N-[(Z)-3-[3-[1-(2,6-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19309522) has the molecular formula C35H35N3O4S and a molecular weight of 593.75 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(2,6-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(2,6-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19309522 |
| Molecular Formula | C35H35N3O4S |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | N-[(Z)-3-[3-[1-(2,6-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2cccc(OC)c2)NC(=O)c2ccccc2)c1)C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C35H35N3O4S/c1-5-31(35(41)38-32-23(2)12-9-13-24(32)3)43-29-19-11-17-27(22-29)36-34(40)30(21-25-14-10-18-28(20-25)42-4)37-33(39)26-15-7-6-8-16-26/h6-22,31H,5H2,1-4H3,(H,36,40)(H,37,39)(H,38,41)/b30-21- |
| InChIKey | AHBLLULJPUXJJQ-OFWBYEQRSA-N |
| XLogP | 7.23 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|