C33H25ClFN5O4S — CID 19713469
N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-oxo-3-[4-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19713469) has the molecular formula C33H25ClFN5O4S and a molecular weight of 642.11 g/mol. Its IUPAC name is N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-oxo-3-[4-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-oxo-3-[4-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19713469 |
| Molecular Formula | C33H25ClFN5O4S |
| Molecular Weight | 642.11 g/mol |
| Exact Mass | 641.13 |
| IUPAC Name | N-[(Z)-1-(2-chloro-6-fluorophenyl)-3-oxo-3-[4-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2c(F)cccc2Cl)NC(=O)c2ccccc2)cc1)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C33H25ClFN5O4S/c34-26-12-7-13-27(35)25(26)18-28(37-32(43)21-8-3-1-4-9-21)33(44)36-22-14-16-24(17-15-22)45-20-30(41)38-29-19-31(42)40(39-29)23-10-5-2-6-11-23/h1-18H,19-20H2,(H,36,44)(H,37,43)(H,38,39,41)/b28-18- |
| InChIKey | GLYKCMPHNXZUNH-VEILYXNESA-N |
| XLogP | 5.85 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.11 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|