C33H26N6O6S — CID 19320625
N-[(E)-1-(4-nitrophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19320625) has the molecular formula C33H26N6O6S and a molecular weight of 634.67 g/mol. Its IUPAC name is N-[(E)-1-(4-nitrophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(4-nitrophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19320625 |
| Molecular Formula | C33H26N6O6S |
| Molecular Weight | 634.67 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | N-[(E)-1-(4-nitrophenyl)-3-oxo-3-[3-[2-oxo-2-[(5-oxo-1-phenyl-4H-pyrazol-3-yl)amino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C\c2ccc([N+](=O)[O-])cc2)NC(=O)c2ccccc2)c1)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C33H26N6O6S/c40-30(36-29-20-31(41)38(37-29)25-11-5-2-6-12-25)21-46-27-13-7-10-24(19-27)34-33(43)28(35-32(42)23-8-3-1-4-9-23)18-22-14-16-26(17-15-22)39(44)45/h1-19H,20-21H2,(H,34,43)(H,35,42)(H,36,37,40)/b28-18+ |
| InChIKey | KTPWSFYHUUZJKA-MTDXEUNCSA-N |
| XLogP | 4.96 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|