C18H15N5O2S — CID 25020985
2-(1H-benzimidazol-2-ylsulfanyl)-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)acetamide (PubChem CID 25020985) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 25020985 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C18H15N5O2S/c24-16(11-26-18-19-13-8-4-5-9-14(13)20-18)21-15-10-17(25)23(22-15)12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,20)(H,21,22,24) |
| InChIKey | USPQADYCERATMN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|