C23H19N3OS — CID 2881771
2-(1H-benzimidazol-2-ylsulfanyl)-N-[4-(2-phenylethenyl)phenyl]acetamide (PubChem CID 2881771) has the molecular formula C23H19N3OS and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-[4-(2-phenylethenyl)phenyl]acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[4-(2-phenylethenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2881771 |
| Molecular Formula | C23H19N3OS |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[4-(2-phenylethenyl)phenyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)Nc1ccc(C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N3OS/c27-22(16-28-23-25-20-8-4-5-9-21(20)26-23)24-19-14-12-18(13-15-19)11-10-17-6-2-1-3-7-17/h1-15H,16H2,(H,24,27)(H,25,26) |
| InChIKey | MHLCGJHVKBYZSC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|