C23H18N4O3S — CID 17386472
2-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]-N-[4-[(E)-2-phenylethenyl]phenyl]acetamide (PubChem CID 17386472) has the molecular formula C23H18N4O3S and a molecular weight of 430.49 g/mol. Its IUPAC name is 2-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]-N-[4-[(E)-2-phenylethenyl]phenyl]acetamide.
| Compound Name | 2-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]-N-[4-[(E)-2-phenylethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 17386472 |
| Molecular Formula | C23H18N4O3S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]-N-[4-[(E)-2-phenylethenyl]phenyl]acetamide |
| SMILES | O=C(CSc1nc2ccc([N+](=O)[O-])cc2[nH]1)Nc1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18N4O3S/c28-22(15-31-23-25-20-13-12-19(27(29)30)14-21(20)26-23)24-18-10-8-17(9-11-18)7-6-16-4-2-1-3-5-16/h1-14H,15H2,(H,24,28)(H,25,26)/b7-6+ |
| InChIKey | YGNASNZMJINQQL-VOTSOKGWSA-N |
| XLogP | 5.37 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|