C16H11ClF2N4O4S — CID 1286275
N-[4-[chloro(difluoro)methoxy]phenyl]-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]acetamide (PubChem CID 1286275) has the molecular formula C16H11ClF2N4O4S and a molecular weight of 428.80 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 1286275 |
| Molecular Formula | C16H11ClF2N4O4S |
| Molecular Weight | 428.80 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2-[(6-nitro-1H-benzimidazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2ccc([N+](=O)[O-])cc2[nH]1)Nc1ccc(OC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C16H11ClF2N4O4S/c17-16(18,19)27-11-4-1-9(2-5-11)20-14(24)8-28-15-21-12-6-3-10(23(25)26)7-13(12)22-15/h1-7H,8H2,(H,20,24)(H,21,22) |
| InChIKey | GEYIUBDFTZCESK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.80 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|