C16H13N3O3S — CID 176729757
N-(4-hydroxyphenyl)-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetamide (PubChem CID 176729757) has the molecular formula C16H13N3O3S and a molecular weight of 327.37 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(4-hydroxyphenyl)-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 176729757 |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)[nH]1)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C16H13N3O3S/c20-11-7-5-10(6-8-11)17-14(21)9-23-16-18-13-4-2-1-3-12(13)15(22)19-16/h1-8,20H,9H2,(H,17,21)(H,18,19,22) |
| InChIKey | MNCLKTJXYIRBJM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|