C16H11FN4O4S — CID 137085002
N-(4-fluoro-3-nitrophenyl)-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetamide (PubChem CID 137085002) has the molecular formula C16H11FN4O4S and a molecular weight of 374.35 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 137085002 |
| Molecular Formula | C16H11FN4O4S |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)[nH]1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11FN4O4S/c17-11-6-5-9(7-13(11)21(24)25)18-14(22)8-26-16-19-12-4-2-1-3-10(12)15(23)20-16/h1-7H,8H2,(H,18,22)(H,19,20,23) |
| InChIKey | IMRZHRCWVPYZHO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|