C17H13N5O5S — CID 172877530
4-nitro-N'-[2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 172877530) has the molecular formula C17H13N5O5S and a molecular weight of 399.39 g/mol. Its IUPAC name is 4-nitro-N'-[2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-nitro-N'-[2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 172877530 |
| Molecular Formula | C17H13N5O5S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-nitro-N'-[2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)[nH]1)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13N5O5S/c23-14(20-21-15(24)10-5-7-11(8-6-10)22(26)27)9-28-17-18-13-4-2-1-3-12(13)16(25)19-17/h1-8H,9H2,(H,20,23)(H,21,24)(H,18,19,25) |
| InChIKey | QKUJGVPOUIYLGV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 147.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|