C21H14N4O4 — CID 136739934
4-nitro-N-[2-(4-oxo-3H-quinazolin-2-yl)phenyl]benzamide (PubChem CID 136739934) has the molecular formula C21H14N4O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is 4-nitro-N-[2-(4-oxo-3H-quinazolin-2-yl)phenyl]benzamide.
| Compound Name | 4-nitro-N-[2-(4-oxo-3H-quinazolin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 136739934 |
| Molecular Formula | C21H14N4O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 4-nitro-N-[2-(4-oxo-3H-quinazolin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccccc2c(=O)[nH]1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H14N4O4/c26-20(13-9-11-14(12-10-13)25(28)29)23-17-7-3-1-5-15(17)19-22-18-8-4-2-6-16(18)21(27)24-19/h1-12H,(H,23,26)(H,22,24,27) |
| InChIKey | AWKBOEXPTWCRTM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|