C21H17N5O2 — CID 135794633
4-hydrazinyl-N-[2-(4-oxo-3H-quinazolin-2-yl)phenyl]benzamide (PubChem CID 135794633) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 4-hydrazinyl-N-[2-(4-oxo-3H-quinazolin-2-yl)phenyl]benzamide.
| Compound Name | 4-hydrazinyl-N-[2-(4-oxo-3H-quinazolin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 135794633 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-hydrazinyl-N-[2-(4-oxo-3H-quinazolin-2-yl)phenyl]benzamide |
| SMILES | NNc1ccc(C(=O)Nc2ccccc2-c2nc3ccccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C21H17N5O2/c22-26-14-11-9-13(10-12-14)20(27)24-17-7-3-1-5-15(17)19-23-18-8-4-2-6-16(18)21(28)25-19/h1-12,26H,22H2,(H,24,27)(H,23,25,28) |
| InChIKey | HGBPWEIEUFAHRM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|