C15H11N3O3 — CID 162513899
2-amino-3-(4-oxo-3H-quinazolin-2-yl)benzoic acid (PubChem CID 162513899) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-amino-3-(4-oxo-3H-quinazolin-2-yl)benzoic acid.
| Compound Name | 2-amino-3-(4-oxo-3H-quinazolin-2-yl)benzoic acid |
|---|---|
| PubChem CID | 162513899 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-amino-3-(4-oxo-3H-quinazolin-2-yl)benzoic acid |
| SMILES | Nc1c(C(=O)O)cccc1-c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H11N3O3/c16-12-9(5-3-6-10(12)15(20)21)13-17-11-7-2-1-4-8(11)14(19)18-13/h1-7H,16H2,(H,20,21)(H,17,18,19) |
| InChIKey | BKACHDUZRCWEEY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|