C16H9F5N2O — CID 168553277
2-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-3H-quinazolin-4-one (PubChem CID 168553277) has the molecular formula C16H9F5N2O and a molecular weight of 340.25 g/mol. Its IUPAC name is 2-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168553277 |
| Molecular Formula | C16H9F5N2O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2ccccc2C(F)(F)C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C16H9F5N2O/c17-15(18,16(19,20)21)11-7-3-1-5-9(11)13-22-12-8-4-2-6-10(12)14(24)23-13/h1-8H,(H,22,23,24) |
| InChIKey | PHBLPQXPMVXPKQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|