C16H12F2N2O2 — CID 168552669
2-[2-(2,2-difluoroethoxy)phenyl]-3H-quinazolin-4-one (PubChem CID 168552669) has the molecular formula C16H12F2N2O2 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)phenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)phenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168552669 |
| Molecular Formula | C16H12F2N2O2 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)phenyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2ccccc2OCC(F)F)nc2ccccc12 |
| InChI | InChI=1S/C16H12F2N2O2/c17-14(18)9-22-13-8-4-2-6-11(13)15-19-12-7-3-1-5-10(12)16(21)20-15/h1-8,14H,9H2,(H,19,20,21) |
| InChIKey | IHZMUENKDYZNML-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |