C20H14N2O5 — CID 168552349
5-[[2-(4-oxo-3H-quinazolin-2-yl)phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 168552349) has the molecular formula C20H14N2O5 and a molecular weight of 362.34 g/mol. Its IUPAC name is 5-[[2-(4-oxo-3H-quinazolin-2-yl)phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-(4-oxo-3H-quinazolin-2-yl)phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 168552349 |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 5-[[2-(4-oxo-3H-quinazolin-2-yl)phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(COc2ccccc2-c2nc3ccccc3c(=O)[nH]2)o1 |
| InChI | InChI=1S/C20H14N2O5/c23-19-13-5-1-3-7-15(13)21-18(22-19)14-6-2-4-8-16(14)26-11-12-9-10-17(27-12)20(24)25/h1-10H,11H2,(H,24,25)(H,21,22,23) |
| InChIKey | JFWAUACDGUVKFY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |