C18H8F10N2O — CID 168552892
2-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-3H-quinazolin-4-one (PubChem CID 168552892) has the molecular formula C18H8F10N2O and a molecular weight of 458.26 g/mol. Its IUPAC name is 2-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168552892 |
| Molecular Formula | C18H8F10N2O |
| Molecular Weight | 458.26 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 2-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(C(F)(F)F)c(C(F)(F)C(F)(F)C(F)(F)F)c2)nc2ccccc12 |
| InChI | InChI=1S/C18H8F10N2O/c19-15(20,17(24,25)18(26,27)28)11-7-8(5-6-10(11)16(21,22)23)13-29-12-4-2-1-3-9(12)14(31)30-13/h1-7H,(H,29,30,31) |
| InChIKey | AEOREXLJMXAWNJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.26 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|