C15H10N4O5 — CID 3993639
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-4-nitrobenzamide (PubChem CID 3993639) has the molecular formula C15H10N4O5 and a molecular weight of 326.27 g/mol. Its IUPAC name is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-4-nitrobenzamide.
| Compound Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 3993639 |
| Molecular Formula | C15H10N4O5 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-4-nitrobenzamide |
| SMILES | O=C(Nc1cccc2c(=O)[nH][nH]c(=O)c12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H10N4O5/c20-13(8-4-6-9(7-5-8)19(23)24)16-11-3-1-2-10-12(11)15(22)18-17-14(10)21/h1-7H,(H,16,20)(H,17,21)(H,18,22) |
| InChIKey | FFDOVAVXVALKOZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|