C21H10Cl2N2O5 — CID 3084759
N-(5,8-dichloro-9,10-dioxoanthracen-1-yl)-4-nitrobenzamide (PubChem CID 3084759) has the molecular formula C21H10Cl2N2O5 and a molecular weight of 441.23 g/mol. Its IUPAC name is N-(5,8-dichloro-9,10-dioxoanthracen-1-yl)-4-nitrobenzamide.
| Compound Name | N-(5,8-dichloro-9,10-dioxoanthracen-1-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 3084759 |
| Molecular Formula | C21H10Cl2N2O5 |
| Molecular Weight | 441.23 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | N-(5,8-dichloro-9,10-dioxoanthracen-1-yl)-4-nitrobenzamide |
| SMILES | O=C(Nc1cccc2c1C(=O)c1c(Cl)ccc(Cl)c1C2=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H10Cl2N2O5/c22-13-8-9-14(23)18-17(13)19(26)12-2-1-3-15(16(12)20(18)27)24-21(28)10-4-6-11(7-5-10)25(29)30/h1-9H,(H,24,28) |
| InChIKey | RCTODXKEYLZWSP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.23 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|