C16H11N3O5 — CID 23904747
N-(2-methyl-1,3-dioxoisoindol-4-yl)-4-nitrobenzamide (PubChem CID 23904747) has the molecular formula C16H11N3O5 and a molecular weight of 325.28 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-4-yl)-4-nitrobenzamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-4-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 23904747 |
| Molecular Formula | C16H11N3O5 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-4-yl)-4-nitrobenzamide |
| SMILES | CN1C(=O)c2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c2C1=O |
| InChI | InChI=1S/C16H11N3O5/c1-18-15(21)11-3-2-4-12(13(11)16(18)22)17-14(20)9-5-7-10(8-6-9)19(23)24/h2-8H,1H3,(H,17,20) |
| InChIKey | BVBSGECWQNJGSG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|