C15H13N5O2S — CID 4690916
N'-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]pyridine-4-carbohydrazide (PubChem CID 4690916) has the molecular formula C15H13N5O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is N'-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]pyridine-4-carbohydrazide.
| Compound Name | N'-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 4690916 |
| Molecular Formula | C15H13N5O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N'-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]pyridine-4-carbohydrazide |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C15H13N5O2S/c21-13(19-20-14(22)10-5-7-16-8-6-10)9-23-15-17-11-3-1-2-4-12(11)18-15/h1-8H,9H2,(H,17,18)(H,19,21)(H,20,22) |
| InChIKey | HRNDDXORCFIYTQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|