C17H15FN4OS — CID 5187301
2-(1H-benzimidazol-2-ylsulfanyl)-N'-[1-(4-fluorophenyl)ethenyl]acetohydrazide (PubChem CID 5187301) has the molecular formula C17H15FN4OS and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N'-[1-(4-fluorophenyl)ethenyl]acetohydrazide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N'-[1-(4-fluorophenyl)ethenyl]acetohydrazide |
|---|---|
| PubChem CID | 5187301 |
| Molecular Formula | C17H15FN4OS |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N'-[1-(4-fluorophenyl)ethenyl]acetohydrazide |
| SMILES | C=C(NNC(=O)CSc1nc2ccccc2[nH]1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN4OS/c1-11(12-6-8-13(18)9-7-12)21-22-16(23)10-24-17-19-14-4-2-3-5-15(14)20-17/h2-9,21H,1,10H2,(H,19,20)(H,22,23) |
| InChIKey | RQXVUXFZGDYQGZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|