C15H13FN4O3S2 — CID 8505393
2-(1H-benzimidazol-2-ylsulfanyl)-N'-(3-fluorophenyl)sulfonylacetohydrazide (PubChem CID 8505393) has the molecular formula C15H13FN4O3S2 and a molecular weight of 380.43 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N'-(3-fluorophenyl)sulfonylacetohydrazide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N'-(3-fluorophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 8505393 |
| Molecular Formula | C15H13FN4O3S2 |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N'-(3-fluorophenyl)sulfonylacetohydrazide |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)NNS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C15H13FN4O3S2/c16-10-4-3-5-11(8-10)25(22,23)20-19-14(21)9-24-15-17-12-6-1-2-7-13(12)18-15/h1-8,20H,9H2,(H,17,18)(H,19,21) |
| InChIKey | LXRPDGFOCZIBMB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|